C15H17F3O3S — CID 10782925
ethyl 4,4,4-trifluoro-2-methyl-2-[(4-methylsulfanylphenyl)methyl]-3-oxobutanoate (PubChem CID 10782925) has the molecular formula C15H17F3O3S and a molecular weight of 334.36 g/mol. Its IUPAC name is ethyl 4,4,4-trifluoro-2-methyl-2-[(4-methylsulfanylphenyl)methyl]-3-oxobutanoate.
| Compound Name | ethyl 4,4,4-trifluoro-2-methyl-2-[(4-methylsulfanylphenyl)methyl]-3-oxobutanoate |
|---|---|
| PubChem CID | 10782925 |
| Molecular Formula | C15H17F3O3S |
| Molecular Weight | 334.36 g/mol |
| Exact Mass | 334.09 |
| IUPAC Name | ethyl 4,4,4-trifluoro-2-methyl-2-[(4-methylsulfanylphenyl)methyl]-3-oxobutanoate |
| SMILES | CCOC(=O)C(C)(Cc1ccc(SC)cc1)C(=O)C(F)(F)F |
| InChI | InChI=1S/C15H17F3O3S/c1-4-21-13(20)14(2,12(19)15(16,17)18)9-10-5-7-11(22-3)8-6-10/h5-8H,4,9H2,1-3H3 |
| InChIKey | ACOUVESXRJWWNO-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.36 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|