C8H14N4O2 — CID 107842329
3-(4-methylpiperazin-1-yl)imidazolidine-2,4-dione (PubChem CID 107842329) has the molecular formula C8H14N4O2 and a molecular weight of 198.23 g/mol. Its IUPAC name is 3-(4-methylpiperazin-1-yl)imidazolidine-2,4-dione.
| Compound Name | 3-(4-methylpiperazin-1-yl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 107842329 |
| Molecular Formula | C8H14N4O2 |
| Molecular Weight | 198.23 g/mol |
| Exact Mass | 198.11 |
| IUPAC Name | 3-(4-methylpiperazin-1-yl)imidazolidine-2,4-dione |
| SMILES | CN1CCN(N2C(=O)CNC2=O)CC1 |
| InChI | InChI=1S/C8H14N4O2/c1-10-2-4-11(5-3-10)12-7(13)6-9-8(12)14/h2-6H2,1H3,(H,9,14) |
| InChIKey | IIXZNNNTUYAYKV-UHFFFAOYSA-N |
| XLogP | -1.30 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.23 |
| LogP ≤ 5 | -1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|