C4H8N2O2 — CID 165132558
3-methylimidazolidine-2,4-dione;molecular hydrogen (PubChem CID 165132558) has the molecular formula C4H8N2O2 and a molecular weight of 116.12 g/mol. Its IUPAC name is 3-methylimidazolidine-2,4-dione;molecular hydrogen.
| Compound Name | 3-methylimidazolidine-2,4-dione;molecular hydrogen |
|---|---|
| PubChem CID | 165132558 |
| Molecular Formula | C4H8N2O2 |
| Molecular Weight | 116.12 g/mol |
| Exact Mass | 116.06 |
| IUPAC Name | 3-methylimidazolidine-2,4-dione;molecular hydrogen |
| SMILES | CN1C(=O)CNC1=O.[H][H] |
| InChI | InChI=1S/C4H6N2O2.H2/c1-6-3(7)2-5-4(6)8;/h2H2,1H3,(H,5,8);1H |
| InChIKey | XPSUEKBCIFSOOR-UHFFFAOYSA-N |
| XLogP | -0.59 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 116.12 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|