C8H10N4O — CID 121388812
2,8-dimethyl-5,6-dihydropteridin-7-one (PubChem CID 121388812) has the molecular formula C8H10N4O and a molecular weight of 178.19 g/mol. Its IUPAC name is 2,8-dimethyl-5,6-dihydropteridin-7-one.
| Compound Name | 2,8-dimethyl-5,6-dihydropteridin-7-one |
|---|---|
| PubChem CID | 121388812 |
| Molecular Formula | C8H10N4O |
| Molecular Weight | 178.19 g/mol |
| Exact Mass | 178.09 |
| IUPAC Name | 2,8-dimethyl-5,6-dihydropteridin-7-one |
| SMILES | Cc1ncc2c(n1)N(C)C(=O)CN2 |
| InChI | InChI=1S/C8H10N4O/c1-5-9-3-6-8(11-5)12(2)7(13)4-10-6/h3,10H,4H2,1-2H3 |
| InChIKey | FXSZCSVPHHTJFO-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.19 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |