About 2-cyano-N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-3-fluorobenzenesulfonamide
2-cyano-N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-3-fluorobenzenesulfonamide (PubChem CID 107857417) has the molecular formula C11H9FN2O4S2
and a molecular weight of 316.34 g/mol. Its IUPAC name is 2-cyano-N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-3-fluorobenzenesulfonamide.
Molecular Properties
| Compound Name | 2-cyano-N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-3-fluorobenzenesulfonamide |
| PubChem CID | 107857417 |
| Molecular Formula | C11H9FN2O4S2 |
| Molecular Weight | 316.34 g/mol |
| Exact Mass | 316.00 |
| IUPAC Name | 2-cyano-N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-3-fluorobenzenesulfonamide |
| SMILES | N#Cc1c(F)cccc1S(=O)(=O)NC1C=CS(=O)(=O)C1 |
| InChI | InChI=1S/C11H9FN2O4S2/c12-10-2-1-3-11(9(10)6-13)20(17,18)14-8-4-5-19(15,16)7-8/h1-5,8,14H,7H2 |
| InChIKey | KZFULXMDWYPULA-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 104.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.34 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-cyano-N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-3-fluorobenzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyano-N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-3-fluorobenzenesulfonamide?
The IUPAC name of 2-cyano-N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-3-fluorobenzenesulfonamide (CID 107857417) is 2-cyano-N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-3-fluorobenzenesulfonamide.
What is the SMILES notation for 2-cyano-N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-3-fluorobenzenesulfonamide?
The canonical SMILES for 2-cyano-N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-3-fluorobenzenesulfonamide is N#Cc1c(F)cccc1S(=O)(=O)NC1C=CS(=O)(=O)C1.
What is the InChIKey of 2-cyano-N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-3-fluorobenzenesulfonamide?
The InChIKey is KZFULXMDWYPULA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9FN2O4S2/c12-10-2-1-3-11(9(10)6-13)20(17,18)14-8-4-5-19(15,16)7-8/h1-5,8,14H,7H2.
What are the key properties of 2-cyano-N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-3-fluorobenzenesulfonamide?
2-cyano-N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-3-fluorobenzenesulfonamide has a molecular weight of 316.34 g/mol, XLogP of 0.29, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyano-N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-3-fluorobenzenesulfonamide is sourced from PubChem (CID 107857417), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).