C11H11FN2O2S2 — CID 113318697
2-cyano-3-fluoro-N-(thiolan-3-yl)benzenesulfonamide (PubChem CID 113318697) has the molecular formula C11H11FN2O2S2 and a molecular weight of 286.35 g/mol. Its IUPAC name is 2-cyano-3-fluoro-N-(thiolan-3-yl)benzenesulfonamide.
| Compound Name | 2-cyano-3-fluoro-N-(thiolan-3-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 113318697 |
| Molecular Formula | C11H11FN2O2S2 |
| Molecular Weight | 286.35 g/mol |
| Exact Mass | 286.02 |
| IUPAC Name | 2-cyano-3-fluoro-N-(thiolan-3-yl)benzenesulfonamide |
| SMILES | N#Cc1c(F)cccc1S(=O)(=O)NC1CCSC1 |
| InChI | InChI=1S/C11H11FN2O2S2/c12-10-2-1-3-11(9(10)6-13)18(15,16)14-8-4-5-17-7-8/h1-3,8,14H,4-5,7H2 |
| InChIKey | USQCMNMOFAMLQS-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.35 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |