C5H9ClN4O2S — CID 107858495
3-chloro-N-(1H-1,2,4-triazol-5-yl)propane-1-sulfonamide (PubChem CID 107858495) has the molecular formula C5H9ClN4O2S and a molecular weight of 224.67 g/mol. Its IUPAC name is 3-chloro-N-(1H-1,2,4-triazol-5-yl)propane-1-sulfonamide.
| Compound Name | 3-chloro-N-(1H-1,2,4-triazol-5-yl)propane-1-sulfonamide |
|---|---|
| PubChem CID | 107858495 |
| Molecular Formula | C5H9ClN4O2S |
| Molecular Weight | 224.67 g/mol |
| Exact Mass | 224.01 |
| IUPAC Name | 3-chloro-N-(1H-1,2,4-triazol-5-yl)propane-1-sulfonamide |
| SMILES | O=S(=O)(CCCCl)Nc1ncn[nH]1 |
| InChI | InChI=1S/C5H9ClN4O2S/c6-2-1-3-13(11,12)10-5-7-4-8-9-5/h4H,1-3H2,(H2,7,8,9,10) |
| InChIKey | KBWVCMAXOFBVJK-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.67 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|