C12H15BrCl2FN — CID 107867124
N-[(2-bromo-3-fluorophenyl)methyl]-1-chloro-2-(chloromethyl)butan-2-amine (PubChem CID 107867124) has the molecular formula C12H15BrCl2FN and a molecular weight of 343.07 g/mol. Its IUPAC name is N-[(2-bromo-3-fluorophenyl)methyl]-1-chloro-2-(chloromethyl)butan-2-amine.
| Compound Name | N-[(2-bromo-3-fluorophenyl)methyl]-1-chloro-2-(chloromethyl)butan-2-amine |
|---|---|
| PubChem CID | 107867124 |
| Molecular Formula | C12H15BrCl2FN |
| Molecular Weight | 343.07 g/mol |
| Exact Mass | 340.97 |
| IUPAC Name | N-[(2-bromo-3-fluorophenyl)methyl]-1-chloro-2-(chloromethyl)butan-2-amine |
| SMILES | CCC(CCl)(CCl)NCc1cccc(F)c1Br |
| InChI | InChI=1S/C12H15BrCl2FN/c1-2-12(7-14,8-15)17-6-9-4-3-5-10(16)11(9)13/h3-5,17H,2,6-8H2,1H3 |
| InChIKey | RDRPECFQBXEVAA-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.07 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|