C9H8BrF4NO — CID 82722991
1-(2-bromo-3-fluorophenyl)-N-(2,2,2-trifluoroethoxy)methanamine (PubChem CID 82722991) has the molecular formula C9H8BrF4NO and a molecular weight of 302.06 g/mol. Its IUPAC name is 1-(2-bromo-3-fluorophenyl)-N-(2,2,2-trifluoroethoxy)methanamine.
| Compound Name | 1-(2-bromo-3-fluorophenyl)-N-(2,2,2-trifluoroethoxy)methanamine |
|---|---|
| PubChem CID | 82722991 |
| Molecular Formula | C9H8BrF4NO |
| Molecular Weight | 302.06 g/mol |
| Exact Mass | 300.97 |
| IUPAC Name | 1-(2-bromo-3-fluorophenyl)-N-(2,2,2-trifluoroethoxy)methanamine |
| SMILES | Fc1cccc(CNOCC(F)(F)F)c1Br |
| InChI | InChI=1S/C9H8BrF4NO/c10-8-6(2-1-3-7(8)11)4-15-16-5-9(12,13)14/h1-3,15H,4-5H2 |
| InChIKey | SNKAWPZYQLUCOD-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.06 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|