C7H16Br2N2O2S — CID 107868283
1-bromo-2-(bromomethyl)-2-(dimethylsulfamoylamino)butane (PubChem CID 107868283) has the molecular formula C7H16Br2N2O2S and a molecular weight of 352.09 g/mol. Its IUPAC name is 1-bromo-2-(bromomethyl)-2-(dimethylsulfamoylamino)butane.
| Compound Name | 1-bromo-2-(bromomethyl)-2-(dimethylsulfamoylamino)butane |
|---|---|
| PubChem CID | 107868283 |
| Molecular Formula | C7H16Br2N2O2S |
| Molecular Weight | 352.09 g/mol |
| Exact Mass | 349.93 |
| IUPAC Name | 1-bromo-2-(bromomethyl)-2-(dimethylsulfamoylamino)butane |
| SMILES | CCC(CBr)(CBr)NS(=O)(=O)N(C)C |
| InChI | InChI=1S/C7H16Br2N2O2S/c1-4-7(5-8,6-9)10-14(12,13)11(2)3/h10H,4-6H2,1-3H3 |
| InChIKey | KUSCSNJYBKJZLC-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.09 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|