C27H25NO2 — CID 10786881
(5Z)-5-[(3-methoxyphenyl)methylidene]-2,2,4-trimethyl-1H-chromeno[3,4-f]quinoline (PubChem CID 10786881) has the molecular formula C27H25NO2 and a molecular weight of 395.50 g/mol. Its IUPAC name is (5Z)-5-[(3-methoxyphenyl)methylidene]-2,2,4-trimethyl-1H-chromeno[3,4-f]quinoline.
| Compound Name | (5Z)-5-[(3-methoxyphenyl)methylidene]-2,2,4-trimethyl-1H-chromeno[3,4-f]quinoline |
|---|---|
| PubChem CID | 10786881 |
| Molecular Formula | C27H25NO2 |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.19 |
| IUPAC Name | (5Z)-5-[(3-methoxyphenyl)methylidene]-2,2,4-trimethyl-1H-chromeno[3,4-f]quinoline |
| SMILES | COc1cccc(/C=C2\Oc3ccccc3-c3ccc4c(c32)C(C)=CC(C)(C)N4)c1 |
| InChI | InChI=1S/C27H25NO2/c1-17-16-27(2,3)28-22-13-12-21-20-10-5-6-11-23(20)30-24(26(21)25(17)22)15-18-8-7-9-19(14-18)29-4/h5-16,28H,1-4H3/b24-15- |
| InChIKey | GWLDFNWDVYCDFE-IWIPYMOSSA-N |
| XLogP | 6.86 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|