C19H32O — CID 107892858
1-(4-tert-butyl-2,6-dimethylphenyl)-3-methylhexan-2-ol (PubChem CID 107892858) has the molecular formula C19H32O and a molecular weight of 276.46 g/mol. Its IUPAC name is 1-(4-tert-butyl-2,6-dimethylphenyl)-3-methylhexan-2-ol.
| Compound Name | 1-(4-tert-butyl-2,6-dimethylphenyl)-3-methylhexan-2-ol |
|---|---|
| PubChem CID | 107892858 |
| Molecular Formula | C19H32O |
| Molecular Weight | 276.46 g/mol |
| Exact Mass | 276.25 |
| IUPAC Name | 1-(4-tert-butyl-2,6-dimethylphenyl)-3-methylhexan-2-ol |
| SMILES | CCCC(C)C(O)Cc1c(C)cc(C(C)(C)C)cc1C |
| InChI | InChI=1S/C19H32O/c1-8-9-13(2)18(20)12-17-14(3)10-16(11-15(17)4)19(5,6)7/h10-11,13,18,20H,8-9,12H2,1-7H3 |
| InChIKey | ZNPJHPAFOHBHEI-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.46 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |