C25H39NO5Si — CID 10790200
tert-butyl N-[(E)-2-[(1R,6S)-6-[tert-butyl(dimethyl)silyl]oxy-2-phenylcyclohex-2-en-1-yl]oxy-2-hydroxyethenyl]carbamate (PubChem CID 10790200) has the molecular formula C25H39NO5Si and a molecular weight of 461.68 g/mol. Its IUPAC name is tert-butyl N-[(E)-2-[(1R,6S)-6-[tert-butyl(dimethyl)silyl]oxy-2-phenylcyclohex-2-en-1-yl]oxy-2-hydroxyethenyl]carbamate.
| Compound Name | tert-butyl N-[(E)-2-[(1R,6S)-6-[tert-butyl(dimethyl)silyl]oxy-2-phenylcyclohex-2-en-1-yl]oxy-2-hydroxyethenyl]carbamate |
|---|---|
| PubChem CID | 10790200 |
| Molecular Formula | C25H39NO5Si |
| Molecular Weight | 461.68 g/mol |
| Exact Mass | 461.26 |
| IUPAC Name | tert-butyl N-[(E)-2-[(1R,6S)-6-[tert-butyl(dimethyl)silyl]oxy-2-phenylcyclohex-2-en-1-yl]oxy-2-hydroxyethenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N/C=C(\O)O[C@@H]1C(c2ccccc2)=CCC[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C25H39NO5Si/c1-24(2,3)30-23(28)26-17-21(27)29-22-19(18-13-10-9-11-14-18)15-12-16-20(22)31-32(7,8)25(4,5)6/h9-11,13-15,17,20,22,27H,12,16H2,1-8H3,(H,26,28)/b21-17+/t20-,22+/m0/s1 |
| InChIKey | PLXDSPKXYUTDPR-NKQZFDIBSA-N |
| XLogP | 6.52 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.68 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|