C24H32Cl2N2O4 — CID 10790984
4-[(3,4-dichlorophenyl)carbamoyl]-5-(dicyclohexylamino)-5-oxopentanoic acid (PubChem CID 10790984) has the molecular formula C24H32Cl2N2O4 and a molecular weight of 483.44 g/mol. Its IUPAC name is 4-[(3,4-dichlorophenyl)carbamoyl]-5-(dicyclohexylamino)-5-oxopentanoic acid.
| Compound Name | 4-[(3,4-dichlorophenyl)carbamoyl]-5-(dicyclohexylamino)-5-oxopentanoic acid |
|---|---|
| PubChem CID | 10790984 |
| Molecular Formula | C24H32Cl2N2O4 |
| Molecular Weight | 483.44 g/mol |
| Exact Mass | 482.17 |
| IUPAC Name | 4-[(3,4-dichlorophenyl)carbamoyl]-5-(dicyclohexylamino)-5-oxopentanoic acid |
| SMILES | O=C(O)CCC(C(=O)Nc1ccc(Cl)c(Cl)c1)C(=O)N(C1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C24H32Cl2N2O4/c25-20-13-11-16(15-21(20)26)27-23(31)19(12-14-22(29)30)24(32)28(17-7-3-1-4-8-17)18-9-5-2-6-10-18/h11,13,15,17-19H,1-10,12,14H2,(H,27,31)(H,29,30) |
| InChIKey | DIWKXCVHYBAQBI-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.44 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|