C11H12Br2N2O — CID 107940197
N-[(E)-4-aminobut-2-enyl]-2,4-dibromobenzamide (PubChem CID 107940197) has the molecular formula C11H12Br2N2O and a molecular weight of 348.04 g/mol. Its IUPAC name is N-[(E)-4-aminobut-2-enyl]-2,4-dibromobenzamide.
| Compound Name | N-[(E)-4-aminobut-2-enyl]-2,4-dibromobenzamide |
|---|---|
| PubChem CID | 107940197 |
| Molecular Formula | C11H12Br2N2O |
| Molecular Weight | 348.04 g/mol |
| Exact Mass | 345.93 |
| IUPAC Name | N-[(E)-4-aminobut-2-enyl]-2,4-dibromobenzamide |
| SMILES | NC/C=C/CNC(=O)c1ccc(Br)cc1Br |
| InChI | InChI=1S/C11H12Br2N2O/c12-8-3-4-9(10(13)7-8)11(16)15-6-2-1-5-14/h1-4,7H,5-6,14H2,(H,15,16)/b2-1+ |
| InChIKey | GQFLAJLINUEZQI-OWOJBTEDSA-N |
| XLogP | 2.46 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.04 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|