C14H31NO — CID 10799444
(4S,5S)-4-amino-3-methyltridecan-5-ol (PubChem CID 10799444) has the molecular formula C14H31NO and a molecular weight of 229.41 g/mol. Its IUPAC name is (4S,5S)-4-amino-3-methyltridecan-5-ol.
| Compound Name | (4S,5S)-4-amino-3-methyltridecan-5-ol |
|---|---|
| PubChem CID | 10799444 |
| Molecular Formula | C14H31NO |
| Molecular Weight | 229.41 g/mol |
| Exact Mass | 229.24 |
| IUPAC Name | (4S,5S)-4-amino-3-methyltridecan-5-ol |
| SMILES | CCCCCCCC[C@H](O)[C@@H](N)C(C)CC |
| InChI | InChI=1S/C14H31NO/c1-4-6-7-8-9-10-11-13(16)14(15)12(3)5-2/h12-14,16H,4-11,15H2,1-3H3/t12?,13-,14-/m0/s1 |
| InChIKey | HKOSWXIDKLLLOA-TTZKSVMKSA-N |
| XLogP | 3.47 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.41 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|