C18H40NO2P — CID 141222321
(2S,3R)-2-amino-1-phosphanyloctadecane-1,3-diol (PubChem CID 141222321) has the molecular formula C18H40NO2P and a molecular weight of 333.50 g/mol. Its IUPAC name is (2S,3R)-2-amino-1-phosphanyloctadecane-1,3-diol.
| Compound Name | (2S,3R)-2-amino-1-phosphanyloctadecane-1,3-diol |
|---|---|
| PubChem CID | 141222321 |
| Molecular Formula | C18H40NO2P |
| Molecular Weight | 333.50 g/mol |
| Exact Mass | 333.28 |
| IUPAC Name | (2S,3R)-2-amino-1-phosphanyloctadecane-1,3-diol |
| SMILES | CCCCCCCCCCCCCCC[C@@H](O)[C@H](N)C(O)P |
| InChI | InChI=1S/C18H40NO2P/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(20)17(19)18(21)22/h16-18,20-21H,2-15,19,22H2,1H3/t16-,17+,18?/m1/s1 |
| InChIKey | ZDJAXQQOJSTQPI-DVKDBIPTSA-N |
| XLogP | 4.35 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.50 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|