C14H15N2O2+ — CID 10800195
(1Z,3E)-1-[(Z)-but-2-enoxy]-1-hydroxy-4-phenylbuta-1,3-diene-2-diazonium (PubChem CID 10800195) has the molecular formula C14H15N2O2+ and a molecular weight of 243.29 g/mol. Its IUPAC name is (1Z,3E)-1-[(Z)-but-2-enoxy]-1-hydroxy-4-phenylbuta-1,3-diene-2-diazonium.
| Compound Name | (1Z,3E)-1-[(Z)-but-2-enoxy]-1-hydroxy-4-phenylbuta-1,3-diene-2-diazonium |
|---|---|
| PubChem CID | 10800195 |
| Molecular Formula | C14H15N2O2+ |
| Molecular Weight | 243.29 g/mol |
| Exact Mass | 243.11 |
| IUPAC Name | (1Z,3E)-1-[(Z)-but-2-enoxy]-1-hydroxy-4-phenylbuta-1,3-diene-2-diazonium |
| SMILES | C/C=C\CO/C(O)=C(/C=C/c1ccccc1)[N+]#N |
| InChI | InChI=1S/C14H14N2O2/c1-2-3-11-18-14(17)13(16-15)10-9-12-7-5-4-6-8-12/h2-10H,11H2,1H3/p+1/b3-2-,10-9+,14-13- |
| InChIKey | CVHMVFLQDQBXDG-QWNCEMGNSA-O |
| XLogP | 3.87 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.29 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Azo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|