C15H22O3S — CID 10802876
(4-methoxy-2-methylideneheptyl)sulfonylbenzene (PubChem CID 10802876) has the molecular formula C15H22O3S and a molecular weight of 282.40 g/mol. Its IUPAC name is (4-methoxy-2-methylideneheptyl)sulfonylbenzene.
| Compound Name | (4-methoxy-2-methylideneheptyl)sulfonylbenzene |
|---|---|
| PubChem CID | 10802876 |
| Molecular Formula | C15H22O3S |
| Molecular Weight | 282.40 g/mol |
| Exact Mass | 282.13 |
| IUPAC Name | (4-methoxy-2-methylideneheptyl)sulfonylbenzene |
| SMILES | C=C(CC(CCC)OC)CS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C15H22O3S/c1-4-8-14(18-3)11-13(2)12-19(16,17)15-9-6-5-7-10-15/h5-7,9-10,14H,2,4,8,11-12H2,1,3H3 |
| InChIKey | SYDUUKLBMDHLRO-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.40 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|