C17H22O3S — CID 10804606
ethyl (1S,2R,5R)-2-methoxy-4-methyl-5-phenylsulfanylcyclohex-3-ene-1-carboxylate (PubChem CID 10804606) has the molecular formula C17H22O3S and a molecular weight of 306.43 g/mol. Its IUPAC name is ethyl (1S,2R,5R)-2-methoxy-4-methyl-5-phenylsulfanylcyclohex-3-ene-1-carboxylate.
| Compound Name | ethyl (1S,2R,5R)-2-methoxy-4-methyl-5-phenylsulfanylcyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 10804606 |
| Molecular Formula | C17H22O3S |
| Molecular Weight | 306.43 g/mol |
| Exact Mass | 306.13 |
| IUPAC Name | ethyl (1S,2R,5R)-2-methoxy-4-methyl-5-phenylsulfanylcyclohex-3-ene-1-carboxylate |
| SMILES | CCOC(=O)[C@H]1C[C@@H](Sc2ccccc2)C(C)=C[C@H]1OC |
| InChI | InChI=1S/C17H22O3S/c1-4-20-17(18)14-11-16(12(2)10-15(14)19-3)21-13-8-6-5-7-9-13/h5-10,14-16H,4,11H2,1-3H3/t14-,15+,16+/m0/s1 |
| InChIKey | LDZFYZGQUOJFMQ-ARFHVFGLSA-N |
| XLogP | 3.69 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.43 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|