C18H36O2Si — CID 10805101
cis-(1S,2S)-2-[(E)-3-[tert-butyl(dimethyl)silyl]oxyprop-1-enyl]-1-(2-methylpropyl)cyclopentan-1-ol (PubChem CID 10805101) has the molecular formula C18H36O2Si and a molecular weight of 312.57 g/mol. Its IUPAC name is cis-(1S,2S)-2-[(E)-3-[tert-butyl(dimethyl)silyl]oxyprop-1-enyl]-1-(2-methylpropyl)cyclopentan-1-ol.
| Compound Name | cis-(1S,2S)-2-[(E)-3-[tert-butyl(dimethyl)silyl]oxyprop-1-enyl]-1-(2-methylpropyl)cyclopentan-1-ol |
|---|---|
| PubChem CID | 10805101 |
| Molecular Formula | C18H36O2Si |
| Molecular Weight | 312.57 g/mol |
| Exact Mass | 312.25 |
| IUPAC Name | cis-(1S,2S)-2-[(E)-3-[tert-butyl(dimethyl)silyl]oxyprop-1-enyl]-1-(2-methylpropyl)cyclopentan-1-ol |
| SMILES | CC(C)C[C@@]1(O)CCC[C@H]1/C=C/CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H36O2Si/c1-15(2)14-18(19)12-8-10-16(18)11-9-13-20-21(6,7)17(3,4)5/h9,11,15-16,19H,8,10,12-14H2,1-7H3/b11-9+/t16-,18-/m0/s1 |
| InChIKey | FBXIOMQNSJZTNC-JQBYDMAESA-N |
| XLogP | 5.14 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.57 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|