C21H44O5Si2 — CID 10812661
tert-butyl (3R,4S)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-oxopentanoate (PubChem CID 10812661) has the molecular formula C21H44O5Si2 and a molecular weight of 432.75 g/mol. Its IUPAC name is tert-butyl (3R,4S)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-oxopentanoate.
| Compound Name | tert-butyl (3R,4S)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-oxopentanoate |
|---|---|
| PubChem CID | 10812661 |
| Molecular Formula | C21H44O5Si2 |
| Molecular Weight | 432.75 g/mol |
| Exact Mass | 432.27 |
| IUPAC Name | tert-butyl (3R,4S)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-oxopentanoate |
| SMILES | CC(C)(C)OC(=O)C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H44O5Si2/c1-19(2,3)24-18(23)14-16(25-27(10,11)20(4,5)6)17(15-22)26-28(12,13)21(7,8)9/h15-17H,14H2,1-13H3/t16-,17-/m1/s1 |
| InChIKey | MFQBVIYSRWKGOX-IAGOWNOFSA-N |
| XLogP | 5.70 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.75 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|