bis(trimethylsilyl) 2,3-bis(trimethylsilyloxy)pentanedioate

C17H40O6Si4 — CID 553137

IUPACbis(trimethylsilyl) 2,3-bis(trimethylsilyloxy)pentanedioate
SMILESC[Si](C)(C)OC(=O)CC(O[Si](C)(C)C)C(O[Si](C)(C)C)C(=O)O[Si](C)(C)C
InChIInChI=1S/C17H40O6Si4/c1-24(2,3)20-14(13-15(18)21-25(4,5)6)16(22-26(7,8)9)17(19)23-27(10,11)12/h14,16H,13H2,1-12H3
InChIKeyUMLJBUXQWLWNFR-UHFFFAOYSA-N
MW452.85 g/mol
LogP4.57
Rot. Bonds10

About bis(trimethylsilyl) 2,3-bis(trimethylsilyloxy)pentanedioate

bis(trimethylsilyl) 2,3-bis(trimethylsilyloxy)pentanedioate (PubChem CID 553137) has the molecular formula C17H40O6Si4 and a molecular weight of 452.85 g/mol. Its IUPAC name is bis(trimethylsilyl) 2,3-bis(trimethylsilyloxy)pentanedioate.

Molecular Properties

Compound Namebis(trimethylsilyl) 2,3-bis(trimethylsilyloxy)pentanedioate
PubChem CID553137
Molecular FormulaC17H40O6Si4
Molecular Weight452.85 g/mol
Exact Mass452.19
IUPAC Namebis(trimethylsilyl) 2,3-bis(trimethylsilyloxy)pentanedioate
SMILESC[Si](C)(C)OC(=O)CC(O[Si](C)(C)C)C(O[Si](C)(C)C)C(=O)O[Si](C)(C)C
InChIInChI=1S/C17H40O6Si4/c1-24(2,3)20-14(13-15(18)21-25(4,5)6)16(22-26(7,8)9)17(19)23-27(10,11)12/h14,16H,13H2,1-12H3
InChIKeyUMLJBUXQWLWNFR-UHFFFAOYSA-N
XLogP4.57
TPSA71.06 Ų
H-Bond Donors
H-Bond Acceptors6
Rotatable Bonds10
Heavy Atoms27
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500452.85
LogP ≤ 54.57
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze bis(trimethylsilyl) 2,3-bis(trimethylsilyloxy)pentanedioate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of bis(trimethylsilyl) 2,3-bis(trimethylsilyloxy)pentanedioate?
The IUPAC name of bis(trimethylsilyl) 2,3-bis(trimethylsilyloxy)pentanedioate (CID 553137) is bis(trimethylsilyl) 2,3-bis(trimethylsilyloxy)pentanedioate.
What is the SMILES notation for bis(trimethylsilyl) 2,3-bis(trimethylsilyloxy)pentanedioate?
The canonical SMILES for bis(trimethylsilyl) 2,3-bis(trimethylsilyloxy)pentanedioate is C[Si](C)(C)OC(=O)CC(O[Si](C)(C)C)C(O[Si](C)(C)C)C(=O)O[Si](C)(C)C.
What is the InChIKey of bis(trimethylsilyl) 2,3-bis(trimethylsilyloxy)pentanedioate?
The InChIKey is UMLJBUXQWLWNFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H40O6Si4/c1-24(2,3)20-14(13-15(18)21-25(4,5)6)16(22-26(7,8)9)17(19)23-27(10,11)12/h14,16H,13H2,1-12H3.
What are the key properties of bis(trimethylsilyl) 2,3-bis(trimethylsilyloxy)pentanedioate?
bis(trimethylsilyl) 2,3-bis(trimethylsilyloxy)pentanedioate has a molecular weight of 452.85 g/mol, XLogP of 4.57, 10 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis(trimethylsilyl) 2,3-bis(trimethylsilyloxy)pentanedioate is sourced from PubChem (CID 553137), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).