C23H22BrNO3 — CID 10812992
ethyl (1S,5R,6R,7S)-2-benzoyl-5-benzyl-7-bromo-2-azabicyclo[4.1.0]hept-3-ene-4-carboxylate (PubChem CID 10812992) has the molecular formula C23H22BrNO3 and a molecular weight of 440.34 g/mol. Its IUPAC name is ethyl (1S,5R,6R,7S)-2-benzoyl-5-benzyl-7-bromo-2-azabicyclo[4.1.0]hept-3-ene-4-carboxylate.
| Compound Name | ethyl (1S,5R,6R,7S)-2-benzoyl-5-benzyl-7-bromo-2-azabicyclo[4.1.0]hept-3-ene-4-carboxylate |
|---|---|
| PubChem CID | 10812992 |
| Molecular Formula | C23H22BrNO3 |
| Molecular Weight | 440.34 g/mol |
| Exact Mass | 439.08 |
| IUPAC Name | ethyl (1S,5R,6R,7S)-2-benzoyl-5-benzyl-7-bromo-2-azabicyclo[4.1.0]hept-3-ene-4-carboxylate |
| SMILES | CCOC(=O)C1=CN(C(=O)c2ccccc2)[C@@H]2[C@@H](Br)[C@@H]2[C@H]1Cc1ccccc1 |
| InChI | InChI=1S/C23H22BrNO3/c1-2-28-23(27)18-14-25(22(26)16-11-7-4-8-12-16)21-19(20(21)24)17(18)13-15-9-5-3-6-10-15/h3-12,14,17,19-21H,2,13H2,1H3/t17-,19-,20-,21-/m0/s1 |
| InChIKey | VIQZLUWUNOGPIY-VMXMFDLUSA-N |
| XLogP | 4.21 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.34 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|