C22H44O5Si2 — CID 10813211
ethyl (E,4S)-4-[tert-butyl(dimethyl)silyl]oxy-5-[(2R)-2-(hydroxymethyl)-3,3-dimethyloxiran-2-yl]-3-(trimethylsilylmethyl)pent-2-enoate (PubChem CID 10813211) has the molecular formula C22H44O5Si2 and a molecular weight of 444.76 g/mol. Its IUPAC name is ethyl (E,4S)-4-[tert-butyl(dimethyl)silyl]oxy-5-[(2R)-2-(hydroxymethyl)-3,3-dimethyloxiran-2-yl]-3-(trimethylsilylmethyl)pent-2-enoate.
| Compound Name | ethyl (E,4S)-4-[tert-butyl(dimethyl)silyl]oxy-5-[(2R)-2-(hydroxymethyl)-3,3-dimethyloxiran-2-yl]-3-(trimethylsilylmethyl)pent-2-enoate |
|---|---|
| PubChem CID | 10813211 |
| Molecular Formula | C22H44O5Si2 |
| Molecular Weight | 444.76 g/mol |
| Exact Mass | 444.27 |
| IUPAC Name | ethyl (E,4S)-4-[tert-butyl(dimethyl)silyl]oxy-5-[(2R)-2-(hydroxymethyl)-3,3-dimethyloxiran-2-yl]-3-(trimethylsilylmethyl)pent-2-enoate |
| SMILES | CCOC(=O)/C=C(/C[Si](C)(C)C)[C@H](C[C@]1(CO)OC1(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H44O5Si2/c1-12-25-19(24)13-17(15-28(7,8)9)18(26-29(10,11)20(2,3)4)14-22(16-23)21(5,6)27-22/h13,18,23H,12,14-16H2,1-11H3/b17-13-/t18-,22+/m0/s1 |
| InChIKey | BMQSSQAXSONDKH-SVYDFSJISA-N |
| XLogP | 5.13 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.76 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|