C19H36O6Si — CID 10739041
methyl (E,4S)-4-[tert-butyl(dimethyl)silyl]oxy-5-[(5R)-5-hydroxy-4,4-dimethyl-1,3-dioxan-5-yl]-3-methylpent-2-enoate (PubChem CID 10739041) has the molecular formula C19H36O6Si and a molecular weight of 388.58 g/mol. Its IUPAC name is methyl (E,4S)-4-[tert-butyl(dimethyl)silyl]oxy-5-[(5R)-5-hydroxy-4,4-dimethyl-1,3-dioxan-5-yl]-3-methylpent-2-enoate.
| Compound Name | methyl (E,4S)-4-[tert-butyl(dimethyl)silyl]oxy-5-[(5R)-5-hydroxy-4,4-dimethyl-1,3-dioxan-5-yl]-3-methylpent-2-enoate |
|---|---|
| PubChem CID | 10739041 |
| Molecular Formula | C19H36O6Si |
| Molecular Weight | 388.58 g/mol |
| Exact Mass | 388.23 |
| IUPAC Name | methyl (E,4S)-4-[tert-butyl(dimethyl)silyl]oxy-5-[(5R)-5-hydroxy-4,4-dimethyl-1,3-dioxan-5-yl]-3-methylpent-2-enoate |
| SMILES | COC(=O)/C=C(\C)[C@H](C[C@@]1(O)COCOC1(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H36O6Si/c1-14(10-16(20)22-7)15(25-26(8,9)17(2,3)4)11-19(21)12-23-13-24-18(19,5)6/h10,15,21H,11-13H2,1-9H3/b14-10+/t15-,19+/m0/s1 |
| InChIKey | LMEQIVIDSOFRTB-WKVQQDHWSA-N |
| XLogP | 3.40 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.58 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|