C22H18Cl2N2O3 — CID 10813473
4,6-dichloro-3-[(E)-3-oxo-3-(1,2,3,4-tetrahydronaphthalen-1-ylamino)prop-1-enyl]-1H-indole-2-carboxylic acid (PubChem CID 10813473) has the molecular formula C22H18Cl2N2O3 and a molecular weight of 429.30 g/mol. Its IUPAC name is 4,6-dichloro-3-[(E)-3-oxo-3-(1,2,3,4-tetrahydronaphthalen-1-ylamino)prop-1-enyl]-1H-indole-2-carboxylic acid.
| Compound Name | 4,6-dichloro-3-[(E)-3-oxo-3-(1,2,3,4-tetrahydronaphthalen-1-ylamino)prop-1-enyl]-1H-indole-2-carboxylic acid |
|---|---|
| PubChem CID | 10813473 |
| Molecular Formula | C22H18Cl2N2O3 |
| Molecular Weight | 429.30 g/mol |
| Exact Mass | 428.07 |
| IUPAC Name | 4,6-dichloro-3-[(E)-3-oxo-3-(1,2,3,4-tetrahydronaphthalen-1-ylamino)prop-1-enyl]-1H-indole-2-carboxylic acid |
| SMILES | O=C(/C=C/c1c(C(=O)O)[nH]c2cc(Cl)cc(Cl)c12)NC1CCCc2ccccc21 |
| InChI | InChI=1S/C22H18Cl2N2O3/c23-13-10-16(24)20-15(21(22(28)29)26-18(20)11-13)8-9-19(27)25-17-7-3-5-12-4-1-2-6-14(12)17/h1-2,4,6,8-11,17,26H,3,5,7H2,(H,25,27)(H,28,29)/b9-8+ |
| InChIKey | SYQHTNJDHANCAE-CMDGGOBGSA-N |
| XLogP | 5.38 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.30 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|