C21H38O8S2 — CID 10814662
[(1R)-1-[(4S,5S)-2,2-dimethyl-5-[(1R)-5-methyl-1-methylsulfonyloxyhex-5-enyl]-1,3-dioxolan-4-yl]-5-methylhex-5-enyl] methanesulfonate (PubChem CID 10814662) has the molecular formula C21H38O8S2 and a molecular weight of 482.66 g/mol. Its IUPAC name is [(1R)-1-[(4S,5S)-2,2-dimethyl-5-[(1R)-5-methyl-1-methylsulfonyloxyhex-5-enyl]-1,3-dioxolan-4-yl]-5-methylhex-5-enyl] methanesulfonate.
| Compound Name | [(1R)-1-[(4S,5S)-2,2-dimethyl-5-[(1R)-5-methyl-1-methylsulfonyloxyhex-5-enyl]-1,3-dioxolan-4-yl]-5-methylhex-5-enyl] methanesulfonate |
|---|---|
| PubChem CID | 10814662 |
| Molecular Formula | C21H38O8S2 |
| Molecular Weight | 482.66 g/mol |
| Exact Mass | 482.20 |
| IUPAC Name | [(1R)-1-[(4S,5S)-2,2-dimethyl-5-[(1R)-5-methyl-1-methylsulfonyloxyhex-5-enyl]-1,3-dioxolan-4-yl]-5-methylhex-5-enyl] methanesulfonate |
| SMILES | C=C(C)CCC[C@@H](OS(C)(=O)=O)[C@H]1OC(C)(C)O[C@@H]1[C@@H](CCCC(=C)C)OS(C)(=O)=O |
| InChI | InChI=1S/C21H38O8S2/c1-15(2)11-9-13-17(28-30(7,22)23)19-20(27-21(5,6)26-19)18(29-31(8,24)25)14-10-12-16(3)4/h17-20H,1,3,9-14H2,2,4-8H3/t17-,18-,19-,20-/m1/s1 |
| InChIKey | KGDZLCLJECIJTD-UAFMIMERSA-N |
| XLogP | 3.69 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.66 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|