C28H38O8 — CID 10815317
(1R,2S)-2-[(1R)-1,2-bis(phenylmethoxymethoxy)ethyl]-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]pent-4-ene-1,2-diol (PubChem CID 10815317) has the molecular formula C28H38O8 and a molecular weight of 502.60 g/mol. Its IUPAC name is (1R,2S)-2-[(1R)-1,2-bis(phenylmethoxymethoxy)ethyl]-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]pent-4-ene-1,2-diol.
| Compound Name | (1R,2S)-2-[(1R)-1,2-bis(phenylmethoxymethoxy)ethyl]-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]pent-4-ene-1,2-diol |
|---|---|
| PubChem CID | 10815317 |
| Molecular Formula | C28H38O8 |
| Molecular Weight | 502.60 g/mol |
| Exact Mass | 502.26 |
| IUPAC Name | (1R,2S)-2-[(1R)-1,2-bis(phenylmethoxymethoxy)ethyl]-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]pent-4-ene-1,2-diol |
| SMILES | C=CC[C@](O)([C@H](O)[C@H]1COC(C)(C)O1)[C@@H](COCOCc1ccccc1)OCOCc1ccccc1 |
| InChI | InChI=1S/C28H38O8/c1-4-15-28(30,26(29)24-18-35-27(2,3)36-24)25(34-21-32-17-23-13-9-6-10-14-23)19-33-20-31-16-22-11-7-5-8-12-22/h4-14,24-26,29-30H,1,15-21H2,2-3H3/t24-,25-,26-,28-/m1/s1 |
| InChIKey | XNUOPNGDJSHVFH-IYUNARRTSA-N |
| XLogP | 3.56 |
| TPSA | 95.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.60 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|