C28H29BrN2O3 — CID 10815845
[(4S,5R,6R)-1,6-dibenzyl-4-[(1S)-1-bromo-2-phenylethyl]-2-oxo-1,3-diazinan-5-yl] acetate (PubChem CID 10815845) has the molecular formula C28H29BrN2O3 and a molecular weight of 521.46 g/mol. Its IUPAC name is [(4S,5R,6R)-1,6-dibenzyl-4-[(1S)-1-bromo-2-phenylethyl]-2-oxo-1,3-diazinan-5-yl] acetate.
| Compound Name | [(4S,5R,6R)-1,6-dibenzyl-4-[(1S)-1-bromo-2-phenylethyl]-2-oxo-1,3-diazinan-5-yl] acetate |
|---|---|
| PubChem CID | 10815845 |
| Molecular Formula | C28H29BrN2O3 |
| Molecular Weight | 521.46 g/mol |
| Exact Mass | 520.14 |
| IUPAC Name | [(4S,5R,6R)-1,6-dibenzyl-4-[(1S)-1-bromo-2-phenylethyl]-2-oxo-1,3-diazinan-5-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@@H]([C@@H](Br)Cc2ccccc2)NC(=O)N(Cc2ccccc2)[C@@H]1Cc1ccccc1 |
| InChI | InChI=1S/C28H29BrN2O3/c1-20(32)34-27-25(18-22-13-7-3-8-14-22)31(19-23-15-9-4-10-16-23)28(33)30-26(27)24(29)17-21-11-5-2-6-12-21/h2-16,24-27H,17-19H2,1H3,(H,30,33)/t24-,25+,26+,27-/m0/s1 |
| InChIKey | RGBQIFIEWDIAID-YAOOYPAMSA-N |
| XLogP | 5.13 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.46 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|