C34H35BrN2O4S — CID 10817971
[(3R,4S,5S)-2,3,6-tribenzyl-5-[(1S)-1-bromo-2-phenylethyl]-1,1-dioxo-1,2,6-thiadiazinan-4-yl] acetate (PubChem CID 10817971) has the molecular formula C34H35BrN2O4S and a molecular weight of 647.64 g/mol. Its IUPAC name is [(3R,4S,5S)-2,3,6-tribenzyl-5-[(1S)-1-bromo-2-phenylethyl]-1,1-dioxo-1,2,6-thiadiazinan-4-yl] acetate.
| Compound Name | [(3R,4S,5S)-2,3,6-tribenzyl-5-[(1S)-1-bromo-2-phenylethyl]-1,1-dioxo-1,2,6-thiadiazinan-4-yl] acetate |
|---|---|
| PubChem CID | 10817971 |
| Molecular Formula | C34H35BrN2O4S |
| Molecular Weight | 647.64 g/mol |
| Exact Mass | 646.15 |
| IUPAC Name | [(3R,4S,5S)-2,3,6-tribenzyl-5-[(1S)-1-bromo-2-phenylethyl]-1,1-dioxo-1,2,6-thiadiazinan-4-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@@H]([C@@H](Br)Cc2ccccc2)N(Cc2ccccc2)S(=O)(=O)N(Cc2ccccc2)[C@@H]1Cc1ccccc1 |
| InChI | InChI=1S/C34H35BrN2O4S/c1-26(38)41-34-32(23-28-16-8-3-9-17-28)36(24-29-18-10-4-11-19-29)42(39,40)37(25-30-20-12-5-13-21-30)33(34)31(35)22-27-14-6-2-7-15-27/h2-21,31-34H,22-25H2,1H3/t31-,32+,33+,34-/m0/s1 |
| InChIKey | IOFOCFUNYBFWEK-YLWZKEKXSA-N |
| XLogP | 6.17 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.64 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|