C39H48N2O10S — CID 501454
(3R,4S,5S,6R)-2-[[4-(2,2-dimethoxyethyl)phenyl]methyl]-7-[[4-(dimethoxymethyl)phenyl]methyl]-1,1-dioxo-3,6-bis(phenoxymethyl)-1,2,7-thiadiazepane-4,5-diol (PubChem CID 501454) has the molecular formula C39H48N2O10S and a molecular weight of 736.88 g/mol. Its IUPAC name is (3R,4S,5S,6R)-2-[[4-(2,2-dimethoxyethyl)phenyl]methyl]-7-[[4-(dimethoxymethyl)phenyl]methyl]-1,1-dioxo-3,6-bis(phenoxymethyl)-1,2,7-thiadiazepane-4,5-diol.
| Compound Name | (3R,4S,5S,6R)-2-[[4-(2,2-dimethoxyethyl)phenyl]methyl]-7-[[4-(dimethoxymethyl)phenyl]methyl]-1,1-dioxo-3,6-bis(phenoxymethyl)-1,2,7-thiadiazepane-4,5-diol |
|---|---|
| PubChem CID | 501454 |
| Molecular Formula | C39H48N2O10S |
| Molecular Weight | 736.88 g/mol |
| Exact Mass | 736.30 |
| IUPAC Name | (3R,4S,5S,6R)-2-[[4-(2,2-dimethoxyethyl)phenyl]methyl]-7-[[4-(dimethoxymethyl)phenyl]methyl]-1,1-dioxo-3,6-bis(phenoxymethyl)-1,2,7-thiadiazepane-4,5-diol |
| SMILES | COC(Cc1ccc(CN2[C@H](COc3ccccc3)[C@H](O)[C@@H](O)[C@@H](COc3ccccc3)N(Cc3ccc(C(OC)OC)cc3)S2(=O)=O)cc1)OC |
| InChI | InChI=1S/C39H48N2O10S/c1-46-36(47-2)23-28-15-17-29(18-16-28)24-40-34(26-50-32-11-7-5-8-12-32)37(42)38(43)35(27-51-33-13-9-6-10-14-33)41(52(40,44)45)25-30-19-21-31(22-20-30)39(48-3)49-4/h5-22,34-39,42-43H,23-27H2,1-4H3/t34-,35-,37+,38+/m1/s1 |
| InChIKey | GREJFHUJPFXXMX-PASMDFPHSA-N |
| XLogP | 4.32 |
| TPSA | 136.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 52 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 736.88 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|