C26H30N2O6S — CID 5327377
(3S,4R)-2-benzyl-7-methyl-1,1-dioxo-3,6-bis(phenoxymethyl)-1,2,7-thiadiazepane-4,5-diol (PubChem CID 5327377) has the molecular formula C26H30N2O6S and a molecular weight of 498.60 g/mol. Its IUPAC name is (3S,4R)-2-benzyl-7-methyl-1,1-dioxo-3,6-bis(phenoxymethyl)-1,2,7-thiadiazepane-4,5-diol.
| Compound Name | (3S,4R)-2-benzyl-7-methyl-1,1-dioxo-3,6-bis(phenoxymethyl)-1,2,7-thiadiazepane-4,5-diol |
|---|---|
| PubChem CID | 5327377 |
| Molecular Formula | C26H30N2O6S |
| Molecular Weight | 498.60 g/mol |
| Exact Mass | 498.18 |
| IUPAC Name | (3S,4R)-2-benzyl-7-methyl-1,1-dioxo-3,6-bis(phenoxymethyl)-1,2,7-thiadiazepane-4,5-diol |
| SMILES | CN1C(COc2ccccc2)C(O)[C@H](O)[C@H](COc2ccccc2)N(Cc2ccccc2)S1(=O)=O |
| InChI | InChI=1S/C26H30N2O6S/c1-27-23(18-33-21-13-7-3-8-14-21)25(29)26(30)24(19-34-22-15-9-4-10-16-22)28(35(27,31)32)17-20-11-5-2-6-12-20/h2-16,23-26,29-30H,17-19H2,1H3/t23?,24-,25?,26+/m0/s1 |
| InChIKey | JGESUXRXNORBLL-DOWAUTBPSA-N |
| XLogP | 2.30 |
| TPSA | 99.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.60 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |