C36H38N2O8S — CID 5327390
1-[3-[[(5R,6S)-7-[(3-acetylphenyl)methyl]-4,5-dihydroxy-1,1-dioxo-3,6-bis(phenoxymethyl)-1,2,7-thiadiazepan-2-yl]methyl]phenyl]ethanone (PubChem CID 5327390) has the molecular formula C36H38N2O8S and a molecular weight of 658.77 g/mol. Its IUPAC name is 1-[3-[[(5R,6S)-7-[(3-acetylphenyl)methyl]-4,5-dihydroxy-1,1-dioxo-3,6-bis(phenoxymethyl)-1,2,7-thiadiazepan-2-yl]methyl]phenyl]ethanone.
| Compound Name | 1-[3-[[(5R,6S)-7-[(3-acetylphenyl)methyl]-4,5-dihydroxy-1,1-dioxo-3,6-bis(phenoxymethyl)-1,2,7-thiadiazepan-2-yl]methyl]phenyl]ethanone |
|---|---|
| PubChem CID | 5327390 |
| Molecular Formula | C36H38N2O8S |
| Molecular Weight | 658.77 g/mol |
| Exact Mass | 658.23 |
| IUPAC Name | 1-[3-[[(5R,6S)-7-[(3-acetylphenyl)methyl]-4,5-dihydroxy-1,1-dioxo-3,6-bis(phenoxymethyl)-1,2,7-thiadiazepan-2-yl]methyl]phenyl]ethanone |
| SMILES | CC(=O)c1cccc(CN2C(COc3ccccc3)C(O)[C@H](O)[C@H](COc3ccccc3)N(Cc3cccc(C(C)=O)c3)S2(=O)=O)c1 |
| InChI | InChI=1S/C36H38N2O8S/c1-25(39)29-13-9-11-27(19-29)21-37-33(23-45-31-15-5-3-6-16-31)35(41)36(42)34(24-46-32-17-7-4-8-18-32)38(47(37,43)44)22-28-12-10-14-30(20-28)26(2)40/h3-20,33-36,41-42H,21-24H2,1-2H3/t33-,34?,35+,36?/m0/s1 |
| InChIKey | SSKLZXDOGDJZRC-HIWVCMMESA-N |
| XLogP | 4.27 |
| TPSA | 133.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.77 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |