C14H17NO4 — CID 70202991
[(2R,3S)-2-benzyl-1-ethoxy-4-oxoazetidin-3-yl] acetate (PubChem CID 70202991) has the molecular formula C14H17NO4 and a molecular weight of 263.29 g/mol. Its IUPAC name is [(2R,3S)-2-benzyl-1-ethoxy-4-oxoazetidin-3-yl] acetate.
| Compound Name | [(2R,3S)-2-benzyl-1-ethoxy-4-oxoazetidin-3-yl] acetate |
|---|---|
| PubChem CID | 70202991 |
| Molecular Formula | C14H17NO4 |
| Molecular Weight | 263.29 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | [(2R,3S)-2-benzyl-1-ethoxy-4-oxoazetidin-3-yl] acetate |
| SMILES | CCON1C(=O)[C@@H](OC(C)=O)[C@H]1Cc1ccccc1 |
| InChI | InChI=1S/C14H17NO4/c1-3-18-15-12(9-11-7-5-4-6-8-11)13(14(15)17)19-10(2)16/h4-8,12-13H,3,9H2,1-2H3/t12-,13+/m1/s1 |
| InChIKey | GSJDRGHXJVSRSI-OLZOCXBDSA-N |
| XLogP | 1.32 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.29 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |