C30H60O5Si2 — CID 10816635
[(2S,3E,5S,6E,8R)-5,8-bis[[tert-butyl(dimethyl)silyl]oxy]-2-hydroxytrideca-3,6-dienyl] 2,2-dimethylpropanoate (PubChem CID 10816635) has the molecular formula C30H60O5Si2 and a molecular weight of 556.98 g/mol. Its IUPAC name is [(2S,3E,5S,6E,8R)-5,8-bis[[tert-butyl(dimethyl)silyl]oxy]-2-hydroxytrideca-3,6-dienyl] 2,2-dimethylpropanoate.
| Compound Name | [(2S,3E,5S,6E,8R)-5,8-bis[[tert-butyl(dimethyl)silyl]oxy]-2-hydroxytrideca-3,6-dienyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 10816635 |
| Molecular Formula | C30H60O5Si2 |
| Molecular Weight | 556.98 g/mol |
| Exact Mass | 556.40 |
| IUPAC Name | [(2S,3E,5S,6E,8R)-5,8-bis[[tert-butyl(dimethyl)silyl]oxy]-2-hydroxytrideca-3,6-dienyl] 2,2-dimethylpropanoate |
| SMILES | CCCCC[C@H](/C=C/[C@H](/C=C/[C@H](O)COC(=O)C(C)(C)C)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C30H60O5Si2/c1-15-16-17-18-25(34-36(11,12)29(5,6)7)21-22-26(35-37(13,14)30(8,9)10)20-19-24(31)23-33-27(32)28(2,3)4/h19-22,24-26,31H,15-18,23H2,1-14H3/b20-19+,22-21+/t24-,25+,26-/m0/s1 |
| InChIKey | VIIQIELBXFBRNB-JIOMEADXSA-N |
| XLogP | 8.41 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.98 |
| LogP ≤ 5 | 8.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|