C20H40O5Si2 — CID 11304604
[(1S,2R,5S,6R)-5,6-bis[[tert-butyl(dimethyl)silyl]oxy]-2-hydroxycyclohex-3-en-1-yl] acetate (PubChem CID 11304604) has the molecular formula C20H40O5Si2 and a molecular weight of 416.71 g/mol. Its IUPAC name is [(1S,2R,5S,6R)-5,6-bis[[tert-butyl(dimethyl)silyl]oxy]-2-hydroxycyclohex-3-en-1-yl] acetate.
| Compound Name | [(1S,2R,5S,6R)-5,6-bis[[tert-butyl(dimethyl)silyl]oxy]-2-hydroxycyclohex-3-en-1-yl] acetate |
|---|---|
| PubChem CID | 11304604 |
| Molecular Formula | C20H40O5Si2 |
| Molecular Weight | 416.71 g/mol |
| Exact Mass | 416.24 |
| IUPAC Name | [(1S,2R,5S,6R)-5,6-bis[[tert-butyl(dimethyl)silyl]oxy]-2-hydroxycyclohex-3-en-1-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)C=C[C@H]1O |
| InChI | InChI=1S/C20H40O5Si2/c1-14(21)23-17-15(22)12-13-16(24-26(8,9)19(2,3)4)18(17)25-27(10,11)20(5,6)7/h12-13,15-18,22H,1-11H3/t15-,16+,17+,18+/m1/s1 |
| InChIKey | JDYACVZAUFCXEO-OWSLCNJRSA-N |
| XLogP | 4.63 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.71 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|