C14H14O — CID 10821813
(1R,9S)-1-methyltricyclo[7.3.1.02,7]trideca-2,4,6,11-tetraen-13-one (PubChem CID 10821813) has the molecular formula C14H14O and a molecular weight of 198.27 g/mol. Its IUPAC name is (1R,9S)-1-methyltricyclo[7.3.1.02,7]trideca-2,4,6,11-tetraen-13-one.
| Compound Name | (1R,9S)-1-methyltricyclo[7.3.1.02,7]trideca-2,4,6,11-tetraen-13-one |
|---|---|
| PubChem CID | 10821813 |
| Molecular Formula | C14H14O |
| Molecular Weight | 198.27 g/mol |
| Exact Mass | 198.10 |
| IUPAC Name | (1R,9S)-1-methyltricyclo[7.3.1.02,7]trideca-2,4,6,11-tetraen-13-one |
| SMILES | C[C@@]12C=CC[C@@H](Cc3ccccc31)C2=O |
| InChI | InChI=1S/C14H14O/c1-14-8-4-6-11(13(14)15)9-10-5-2-3-7-12(10)14/h2-5,7-8,11H,6,9H2,1H3/t11-,14+/m0/s1 |
| InChIKey | AIFWQTSHIVGYDC-SMDDNHRTSA-N |
| XLogP | 2.65 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.27 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|