C14H14O2 — CID 10822519
6,8-dimethyl-2,3-dihydro-1H-dibenzofuran-4-one (PubChem CID 10822519) has the molecular formula C14H14O2 and a molecular weight of 214.26 g/mol. Its IUPAC name is 6,8-dimethyl-2,3-dihydro-1H-dibenzofuran-4-one.
| Compound Name | 6,8-dimethyl-2,3-dihydro-1H-dibenzofuran-4-one |
|---|---|
| PubChem CID | 10822519 |
| Molecular Formula | C14H14O2 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.10 |
| IUPAC Name | 6,8-dimethyl-2,3-dihydro-1H-dibenzofuran-4-one |
| SMILES | Cc1cc(C)c2oc3c(c2c1)CCCC3=O |
| InChI | InChI=1S/C14H14O2/c1-8-6-9(2)13-11(7-8)10-4-3-5-12(15)14(10)16-13/h6-7H,3-5H2,1-2H3 |
| InChIKey | KZIZHACGFAHWCC-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |