C40H32O8 — CID 161443528
methane;1,7,9-trimethyl-3-[(1,7,9-trimethyl-5,11-dioxochromeno[4,3-c]chromen-3-yl)methyl]chromeno[4,3-c]chromene-5,11-dione (PubChem CID 161443528) has the molecular formula C40H32O8 and a molecular weight of 640.69 g/mol. Its IUPAC name is methane;1,7,9-trimethyl-3-[(1,7,9-trimethyl-5,11-dioxochromeno[4,3-c]chromen-3-yl)methyl]chromeno[4,3-c]chromene-5,11-dione.
| Compound Name | methane;1,7,9-trimethyl-3-[(1,7,9-trimethyl-5,11-dioxochromeno[4,3-c]chromen-3-yl)methyl]chromeno[4,3-c]chromene-5,11-dione |
|---|---|
| PubChem CID | 161443528 |
| Molecular Formula | C40H32O8 |
| Molecular Weight | 640.69 g/mol |
| Exact Mass | 640.21 |
| IUPAC Name | methane;1,7,9-trimethyl-3-[(1,7,9-trimethyl-5,11-dioxochromeno[4,3-c]chromen-3-yl)methyl]chromeno[4,3-c]chromene-5,11-dione |
| SMILES | C.Cc1cc(C)c2oc(=O)c3c4cc(Cc5cc(C)c6oc(=O)c7c8cc(C)cc(C)c8oc(=O)c7c6c5)cc(C)c4oc(=O)c3c2c1 |
| InChI | InChI=1S/C39H28O8.CH4/c1-16-7-18(3)32-24(9-16)28-30(38(42)44-32)26-14-22(11-20(5)34(26)46-36(28)40)13-23-12-21(6)35-27(15-23)31-29(37(41)47-35)25-10-17(2)8-19(4)33(25)45-39(31)43;/h7-12,14-15H,13H2,1-6H3;1H4 |
| InChIKey | VZPFZDQSTMWHCK-UHFFFAOYSA-N |
| XLogP | 8.50 |
| TPSA | 120.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.69 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|