C17H13ClN2O3 — CID 137098687
3-[(3-chlorophenyl)diazenyl]-4-hydroxy-6,8-dimethylchromen-2-one (PubChem CID 137098687) has the molecular formula C17H13ClN2O3 and a molecular weight of 328.76 g/mol. Its IUPAC name is 3-[(3-chlorophenyl)diazenyl]-4-hydroxy-6,8-dimethylchromen-2-one.
| Compound Name | 3-[(3-chlorophenyl)diazenyl]-4-hydroxy-6,8-dimethylchromen-2-one |
|---|---|
| PubChem CID | 137098687 |
| Molecular Formula | C17H13ClN2O3 |
| Molecular Weight | 328.76 g/mol |
| Exact Mass | 328.06 |
| IUPAC Name | 3-[(3-chlorophenyl)diazenyl]-4-hydroxy-6,8-dimethylchromen-2-one |
| SMILES | Cc1cc(C)c2oc(=O)c(/N=N/c3cccc(Cl)c3)c(O)c2c1 |
| InChI | InChI=1S/C17H13ClN2O3/c1-9-6-10(2)16-13(7-9)15(21)14(17(22)23-16)20-19-12-5-3-4-11(18)8-12/h3-8,21H,1-2H3/b20-19+ |
| InChIKey | ZHPJNAIYFAGQRW-FMQUCBEESA-N |
| XLogP | 5.18 |
| TPSA | 75.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.76 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|