C12H9BrO2 — CID 10730368
8-bromo-2,3-dihydro-1H-dibenzofuran-4-one (PubChem CID 10730368) has the molecular formula C12H9BrO2 and a molecular weight of 265.11 g/mol. Its IUPAC name is 8-bromo-2,3-dihydro-1H-dibenzofuran-4-one.
| Compound Name | 8-bromo-2,3-dihydro-1H-dibenzofuran-4-one |
|---|---|
| PubChem CID | 10730368 |
| Molecular Formula | C12H9BrO2 |
| Molecular Weight | 265.11 g/mol |
| Exact Mass | 263.98 |
| IUPAC Name | 8-bromo-2,3-dihydro-1H-dibenzofuran-4-one |
| SMILES | O=C1CCCc2c1oc1ccc(Br)cc21 |
| InChI | InChI=1S/C12H9BrO2/c13-7-4-5-11-9(6-7)8-2-1-3-10(14)12(8)15-11/h4-6H,1-3H2 |
| InChIKey | JYBFVGPMJUVNKE-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.11 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |