C17H23NO2 — CID 10826127
(5E)-1-benzyl-8-methoxy-8-methyl-2,3,4,7-tetrahydroazonin-9-one (PubChem CID 10826127) has the molecular formula C17H23NO2 and a molecular weight of 273.38 g/mol. Its IUPAC name is (5E)-1-benzyl-8-methoxy-8-methyl-2,3,4,7-tetrahydroazonin-9-one.
| Compound Name | (5E)-1-benzyl-8-methoxy-8-methyl-2,3,4,7-tetrahydroazonin-9-one |
|---|---|
| PubChem CID | 10826127 |
| Molecular Formula | C17H23NO2 |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.17 |
| IUPAC Name | (5E)-1-benzyl-8-methoxy-8-methyl-2,3,4,7-tetrahydroazonin-9-one |
| SMILES | COC1(C)C/C=C/CCCN(Cc2ccccc2)C1=O |
| InChI | InChI=1S/C17H23NO2/c1-17(20-2)12-8-3-4-9-13-18(16(17)19)14-15-10-6-5-7-11-15/h3,5-8,10-11H,4,9,12-14H2,1-2H3/b8-3+ |
| InChIKey | KQPALKYALQSMOB-FPYGCLRLSA-N |
| XLogP | 3.16 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|