C15H18F2OS — CID 10826927
1-(1,1-difluoro-2-phenylsulfanylprop-2-enyl)cyclohexan-1-ol (PubChem CID 10826927) has the molecular formula C15H18F2OS and a molecular weight of 284.37 g/mol. Its IUPAC name is 1-(1,1-difluoro-2-phenylsulfanylprop-2-enyl)cyclohexan-1-ol.
| Compound Name | 1-(1,1-difluoro-2-phenylsulfanylprop-2-enyl)cyclohexan-1-ol |
|---|---|
| PubChem CID | 10826927 |
| Molecular Formula | C15H18F2OS |
| Molecular Weight | 284.37 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | 1-(1,1-difluoro-2-phenylsulfanylprop-2-enyl)cyclohexan-1-ol |
| SMILES | C=C(Sc1ccccc1)C(F)(F)C1(O)CCCCC1 |
| InChI | InChI=1S/C15H18F2OS/c1-12(19-13-8-4-2-5-9-13)15(16,17)14(18)10-6-3-7-11-14/h2,4-5,8-9,18H,1,3,6-7,10-11H2 |
| InChIKey | DUBXHEMCMYKNIH-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.37 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |