C22H24 — CID 10827237
[(1E,3E)-3-benzylidene-4-methyl-2-propan-2-ylpenta-1,4-dienyl]benzene (PubChem CID 10827237) has the molecular formula C22H24 and a molecular weight of 288.43 g/mol. Its IUPAC name is [(1E,3E)-3-benzylidene-4-methyl-2-propan-2-ylpenta-1,4-dienyl]benzene.
| Compound Name | [(1E,3E)-3-benzylidene-4-methyl-2-propan-2-ylpenta-1,4-dienyl]benzene |
|---|---|
| PubChem CID | 10827237 |
| Molecular Formula | C22H24 |
| Molecular Weight | 288.43 g/mol |
| Exact Mass | 288.19 |
| IUPAC Name | [(1E,3E)-3-benzylidene-4-methyl-2-propan-2-ylpenta-1,4-dienyl]benzene |
| SMILES | C=C(C)C(=C\c1ccccc1)/C(=C/c1ccccc1)C(C)C |
| InChI | InChI=1S/C22H24/c1-17(2)21(15-19-11-7-5-8-12-19)22(18(3)4)16-20-13-9-6-10-14-20/h5-16,18H,1H2,2-4H3/b21-15+,22-16+ |
| InChIKey | LHEVJMQUWVGUCZ-YHARCJFQSA-N |
| XLogP | 6.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.43 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|