C15H20O6 — CID 10827762
methyl (3S,3aS,7aS)-3-acetyl-4-formyl-3a,5-dimethyl-2-oxo-4,6,7,7a-tetrahydro-3H-1-benzofuran-5-carboxylate (PubChem CID 10827762) has the molecular formula C15H20O6 and a molecular weight of 296.32 g/mol. Its IUPAC name is methyl (3S,3aS,7aS)-3-acetyl-4-formyl-3a,5-dimethyl-2-oxo-4,6,7,7a-tetrahydro-3H-1-benzofuran-5-carboxylate.
| Compound Name | methyl (3S,3aS,7aS)-3-acetyl-4-formyl-3a,5-dimethyl-2-oxo-4,6,7,7a-tetrahydro-3H-1-benzofuran-5-carboxylate |
|---|---|
| PubChem CID | 10827762 |
| Molecular Formula | C15H20O6 |
| Molecular Weight | 296.32 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | methyl (3S,3aS,7aS)-3-acetyl-4-formyl-3a,5-dimethyl-2-oxo-4,6,7,7a-tetrahydro-3H-1-benzofuran-5-carboxylate |
| SMILES | COC(=O)C1(C)CC[C@@H]2OC(=O)[C@H](C(C)=O)[C@]2(C)C1C=O |
| InChI | InChI=1S/C15H20O6/c1-8(17)11-12(18)21-10-5-6-14(2,13(19)20-4)9(7-16)15(10,11)3/h7,9-11H,5-6H2,1-4H3/t9?,10-,11-,14?,15+/m0/s1 |
| InChIKey | LPFHWGAYHGDRRE-ULZMVXRWSA-N |
| XLogP | 0.91 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.32 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|