C14H20O5 — CID 23253647
methyl 3-[(3aR,5S,7aR)-5,7a-dimethyl-2,4-dioxo-3,5,6,7-tetrahydro-1-benzofuran-3a-yl]propanoate (PubChem CID 23253647) has the molecular formula C14H20O5 and a molecular weight of 268.31 g/mol. Its IUPAC name is methyl 3-[(3aR,5S,7aR)-5,7a-dimethyl-2,4-dioxo-3,5,6,7-tetrahydro-1-benzofuran-3a-yl]propanoate.
| Compound Name | methyl 3-[(3aR,5S,7aR)-5,7a-dimethyl-2,4-dioxo-3,5,6,7-tetrahydro-1-benzofuran-3a-yl]propanoate |
|---|---|
| PubChem CID | 23253647 |
| Molecular Formula | C14H20O5 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | methyl 3-[(3aR,5S,7aR)-5,7a-dimethyl-2,4-dioxo-3,5,6,7-tetrahydro-1-benzofuran-3a-yl]propanoate |
| SMILES | COC(=O)CC[C@@]12CC(=O)O[C@]1(C)CC[C@H](C)C2=O |
| InChI | InChI=1S/C14H20O5/c1-9-4-6-13(2)14(12(9)17,8-11(16)19-13)7-5-10(15)18-3/h9H,4-8H2,1-3H3/t9-,13+,14-/m0/s1 |
| InChIKey | QLFQTUHEFRXFOR-FZZIBODNSA-N |
| XLogP | 1.63 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |