C15H22O5 — CID 10924004
methyl 2-[(3aR,4S,7aS)-3a,4,7,7-tetramethyl-2,5-dioxo-6,7a-dihydro-3H-1-benzofuran-4-yl]acetate (PubChem CID 10924004) has the molecular formula C15H22O5 and a molecular weight of 282.34 g/mol. Its IUPAC name is methyl 2-[(3aR,4S,7aS)-3a,4,7,7-tetramethyl-2,5-dioxo-6,7a-dihydro-3H-1-benzofuran-4-yl]acetate.
| Compound Name | methyl 2-[(3aR,4S,7aS)-3a,4,7,7-tetramethyl-2,5-dioxo-6,7a-dihydro-3H-1-benzofuran-4-yl]acetate |
|---|---|
| PubChem CID | 10924004 |
| Molecular Formula | C15H22O5 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | methyl 2-[(3aR,4S,7aS)-3a,4,7,7-tetramethyl-2,5-dioxo-6,7a-dihydro-3H-1-benzofuran-4-yl]acetate |
| SMILES | COC(=O)C[C@]1(C)C(=O)CC(C)(C)[C@@H]2OC(=O)C[C@@]21C |
| InChI | InChI=1S/C15H22O5/c1-13(2)6-9(16)14(3,7-10(17)19-5)15(4)8-11(18)20-12(13)15/h12H,6-8H2,1-5H3/t12-,14+,15-/m0/s1 |
| InChIKey | NUZZERAFEZGSDA-CFVMTHIKSA-N |
| XLogP | 1.88 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |