C18H26O2Si — CID 10828236
(1S,3aS,8aR,9R,9aR)-1-methyl-9-(2-trimethylsilylethynyl)-3a,5,6,7,8,8a,9,9a-octahydro-1H-benzo[f][2]benzofuran-3-one (PubChem CID 10828236) has the molecular formula C18H26O2Si and a molecular weight of 302.49 g/mol. Its IUPAC name is (1S,3aS,8aR,9R,9aR)-1-methyl-9-(2-trimethylsilylethynyl)-3a,5,6,7,8,8a,9,9a-octahydro-1H-benzo[f][2]benzofuran-3-one.
| Compound Name | (1S,3aS,8aR,9R,9aR)-1-methyl-9-(2-trimethylsilylethynyl)-3a,5,6,7,8,8a,9,9a-octahydro-1H-benzo[f][2]benzofuran-3-one |
|---|---|
| PubChem CID | 10828236 |
| Molecular Formula | C18H26O2Si |
| Molecular Weight | 302.49 g/mol |
| Exact Mass | 302.17 |
| IUPAC Name | (1S,3aS,8aR,9R,9aR)-1-methyl-9-(2-trimethylsilylethynyl)-3a,5,6,7,8,8a,9,9a-octahydro-1H-benzo[f][2]benzofuran-3-one |
| SMILES | C[C@@H]1OC(=O)[C@H]2C=C3CCCC[C@@H]3[C@@H](C#C[Si](C)(C)C)[C@@H]12 |
| InChI | InChI=1S/C18H26O2Si/c1-12-17-15(9-10-21(2,3)4)14-8-6-5-7-13(14)11-16(17)18(19)20-12/h11-12,14-17H,5-8H2,1-4H3/t12-,14-,15+,16-,17+/m0/s1 |
| InChIKey | AKLGUYSXPSQPFY-BTYMGIQYSA-N |
| XLogP | 3.79 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.49 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|