C14H18N2O5 — CID 70882136
(1R,3aS,8aS,9S,9aS)-1-methyl-6-nitro-3-oxo-3a,5,6,7,8,8a,9,9a-octahydro-1H-benzo[f][2]benzofuran-9-carboxamide (PubChem CID 70882136) has the molecular formula C14H18N2O5 and a molecular weight of 294.31 g/mol. Its IUPAC name is (1R,3aS,8aS,9S,9aS)-1-methyl-6-nitro-3-oxo-3a,5,6,7,8,8a,9,9a-octahydro-1H-benzo[f][2]benzofuran-9-carboxamide.
| Compound Name | (1R,3aS,8aS,9S,9aS)-1-methyl-6-nitro-3-oxo-3a,5,6,7,8,8a,9,9a-octahydro-1H-benzo[f][2]benzofuran-9-carboxamide |
|---|---|
| PubChem CID | 70882136 |
| Molecular Formula | C14H18N2O5 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | (1R,3aS,8aS,9S,9aS)-1-methyl-6-nitro-3-oxo-3a,5,6,7,8,8a,9,9a-octahydro-1H-benzo[f][2]benzofuran-9-carboxamide |
| SMILES | C[C@H]1OC(=O)[C@H]2C=C3CC([N+](=O)[O-])CC[C@H]3[C@H](C(N)=O)[C@@H]21 |
| InChI | InChI=1S/C14H18N2O5/c1-6-11-10(14(18)21-6)5-7-4-8(16(19)20)2-3-9(7)12(11)13(15)17/h5-6,8-12H,2-4H2,1H3,(H2,15,17)/t6-,8?,9-,10+,11-,12+/m1/s1 |
| InChIKey | PTGNXRQHZKRBGM-PMIYBDATSA-N |
| XLogP | 0.65 |
| TPSA | 112.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|